C24H46N2O2 — CID 87307707
N-(3-aminohexyl)-11-(3-pentyloxiran-2-yl)undec-9-enamide (PubChem CID 87307707) has the molecular formula C24H46N2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is N-(3-aminohexyl)-11-(3-pentyloxiran-2-yl)undec-9-enamide.
| Compound Name | N-(3-aminohexyl)-11-(3-pentyloxiran-2-yl)undec-9-enamide |
|---|---|
| PubChem CID | 87307707 |
| Molecular Formula | C24H46N2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | N-(3-aminohexyl)-11-(3-pentyloxiran-2-yl)undec-9-enamide |
| SMILES | CCCCCC1OC1CC=CCCCCCCCC(=O)NCCC(N)CCC |
| InChI | InChI=1S/C24H46N2O2/c1-3-5-12-16-22-23(28-22)17-13-10-8-6-7-9-11-14-18-24(27)26-20-19-21(25)15-4-2/h10,13,21-23H,3-9,11-12,14-20,25H2,1-2H3,(H,26,27) |
| InChIKey | MXAGYRUQHKYIFI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|