C20H38N2O2 — CID 123993358
N-(2-aminoethyl)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enamide (PubChem CID 123993358) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is N-(2-aminoethyl)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enamide.
| Compound Name | N-(2-aminoethyl)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enamide |
|---|---|
| PubChem CID | 123993358 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | N-(2-aminoethyl)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enamide |
| SMILES | CCCCC[C@H]1O[C@H]1CC=CCCCCCCCC(=O)NCCN |
| InChI | InChI=1S/C20H38N2O2/c1-2-3-10-13-18-19(24-18)14-11-8-6-4-5-7-9-12-15-20(23)22-17-16-21/h8,11,18-19H,2-7,9-10,12-17,21H2,1H3,(H,22,23)/t18-,19+/m1/s1 |
| InChIKey | WVTXBLJLKAXCHD-MOPGFXCFSA-N |
| XLogP | 4.09 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|