C20H36O3 — CID 163075251
ethyl 11-(3-pentyloxiran-2-yl)undec-9-enoate (PubChem CID 163075251) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is ethyl 11-(3-pentyloxiran-2-yl)undec-9-enoate.
| Compound Name | ethyl 11-(3-pentyloxiran-2-yl)undec-9-enoate |
|---|---|
| PubChem CID | 163075251 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | ethyl 11-(3-pentyloxiran-2-yl)undec-9-enoate |
| SMILES | CCCCCC1OC1CC=CCCCCCCCC(=O)OCC |
| InChI | InChI=1S/C20H36O3/c1-3-5-12-15-18-19(23-18)16-13-10-8-6-7-9-11-14-17-20(21)22-4-2/h10,13,18-19H,3-9,11-12,14-17H2,1-2H3 |
| InChIKey | XJNIXCSLMHLSTK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|