C24H44O3 — CID 162910210
[(3R)-3-methylpentyl] (Z)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enoate (PubChem CID 162910210) has the molecular formula C24H44O3 and a molecular weight of 380.61 g/mol. Its IUPAC name is [(3R)-3-methylpentyl] (Z)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enoate.
| Compound Name | [(3R)-3-methylpentyl] (Z)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enoate |
|---|---|
| PubChem CID | 162910210 |
| Molecular Formula | C24H44O3 |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | [(3R)-3-methylpentyl] (Z)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enoate |
| SMILES | CCCCC[C@H]1O[C@H]1C/C=C\CCCCCCCC(=O)OCC[C@H](C)CC |
| InChI | InChI=1S/C24H44O3/c1-4-6-13-16-22-23(27-22)17-14-11-9-7-8-10-12-15-18-24(25)26-20-19-21(3)5-2/h11,14,21-23H,4-10,12-13,15-20H2,1-3H3/b14-11-/t21-,22-,23+/m1/s1 |
| InChIKey | MLPHPBFWRYBESN-VNZLYBFWSA-N |
| XLogP | 6.99 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|