C19H20O — CID 135026635
(1S,2S)-2-benzyl-5,8-dimethyl-1,2-dihydronaphthalen-1-ol (PubChem CID 135026635) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is (1S,2S)-2-benzyl-5,8-dimethyl-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1S,2S)-2-benzyl-5,8-dimethyl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 135026635 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1S,2S)-2-benzyl-5,8-dimethyl-1,2-dihydronaphthalen-1-ol |
| SMILES | Cc1ccc(C)c2c1C=C[C@H](Cc1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C19H20O/c1-13-8-9-14(2)18-17(13)11-10-16(19(18)20)12-15-6-4-3-5-7-15/h3-11,16,19-20H,12H2,1-2H3/t16-,19+/m1/s1 |
| InChIKey | LOKLHTXZWHPRGV-APWZRJJASA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |