C23H38ClNO — CID 19833498
2,4-dimethyl-9-(octylamino)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-1-ol;hydrochloride (PubChem CID 19833498) has the molecular formula C23H38ClNO and a molecular weight of 380.02 g/mol. Its IUPAC name is 2,4-dimethyl-9-(octylamino)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-1-ol;hydrochloride.
| Compound Name | 2,4-dimethyl-9-(octylamino)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-1-ol;hydrochloride |
|---|---|
| PubChem CID | 19833498 |
| Molecular Formula | C23H38ClNO |
| Molecular Weight | 380.02 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 2,4-dimethyl-9-(octylamino)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-1-ol;hydrochloride |
| SMILES | CCCCCCCCNC1c2c(O)c(C)cc(C)c2C2CCCCC21.Cl |
| InChI | InChI=1S/C23H37NO.ClH/c1-4-5-6-7-8-11-14-24-22-19-13-10-9-12-18(19)20-16(2)15-17(3)23(25)21(20)22;/h15,18-19,22,24-25H,4-14H2,1-3H3;1H |
| InChIKey | ZQBDLFPJUQZNSH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.02 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|