About 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene
2-cyclopentyl-1,3-dimethyl-5-pentylbenzene (PubChem CID 176571033) has the molecular formula C18H28
and a molecular weight of 244.42 g/mol. Its IUPAC name is 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene.
Molecular Properties
| Compound Name | 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene |
| PubChem CID | 176571033 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene |
| SMILES | CCCCCc1cc(C)c(C2CCCC2)c(C)c1 |
| InChI | InChI=1S/C18H28/c1-4-5-6-9-16-12-14(2)18(15(3)13-16)17-10-7-8-11-17/h12-13,17H,4-11H2,1-3H3 |
| InChIKey | KEKUSPOHWRQUAP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene?
The IUPAC name of 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene (CID 176571033) is 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene.
What is the SMILES notation for 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene?
The canonical SMILES for 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene is CCCCCc1cc(C)c(C2CCCC2)c(C)c1.
What is the InChIKey of 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene?
The InChIKey is KEKUSPOHWRQUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28/c1-4-5-6-9-16-12-14(2)18(15(3)13-16)17-10-7-8-11-17/h12-13,17H,4-11H2,1-3H3.
What are the key properties of 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene?
2-cyclopentyl-1,3-dimethyl-5-pentylbenzene has a molecular weight of 244.42 g/mol, XLogP of 5.69, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-1,3-dimethyl-5-pentylbenzene is sourced from PubChem (CID 176571033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).