C21H32O2 — CID 176660892
5-heptyl-2-[3-(hydroxymethyl)cyclohex-2-en-1-yl]-3-methylphenol (PubChem CID 176660892) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 5-heptyl-2-[3-(hydroxymethyl)cyclohex-2-en-1-yl]-3-methylphenol.
| Compound Name | 5-heptyl-2-[3-(hydroxymethyl)cyclohex-2-en-1-yl]-3-methylphenol |
|---|---|
| PubChem CID | 176660892 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 5-heptyl-2-[3-(hydroxymethyl)cyclohex-2-en-1-yl]-3-methylphenol |
| SMILES | CCCCCCCc1cc(C)c(C2C=C(CO)CCC2)c(O)c1 |
| InChI | InChI=1S/C21H32O2/c1-3-4-5-6-7-9-17-12-16(2)21(20(23)14-17)19-11-8-10-18(13-19)15-22/h12-14,19,22-23H,3-11,15H2,1-2H3 |
| InChIKey | QOBISIPSXBNSBS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|