C52H86N2 — CID 102009313
1-(3,5-dioctylphenyl)-N-[(1R,2R)-2-[(3,5-dioctylphenyl)methylideneamino]cyclohexyl]methanimine (PubChem CID 102009313) has the molecular formula C52H86N2 and a molecular weight of 739.27 g/mol. Its IUPAC name is 1-(3,5-dioctylphenyl)-N-[(1R,2R)-2-[(3,5-dioctylphenyl)methylideneamino]cyclohexyl]methanimine.
| Compound Name | 1-(3,5-dioctylphenyl)-N-[(1R,2R)-2-[(3,5-dioctylphenyl)methylideneamino]cyclohexyl]methanimine |
|---|---|
| PubChem CID | 102009313 |
| Molecular Formula | C52H86N2 |
| Molecular Weight | 739.27 g/mol |
| Exact Mass | 738.68 |
| IUPAC Name | 1-(3,5-dioctylphenyl)-N-[(1R,2R)-2-[(3,5-dioctylphenyl)methylideneamino]cyclohexyl]methanimine |
| SMILES | CCCCCCCCc1cc(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(CCCCCCCC)cc(CCCCCCCC)c2)cc(CCCCCCCC)c1 |
| InChI | InChI=1S/C52H86N2/c1-5-9-13-17-21-25-31-45-37-46(32-26-22-18-14-10-6-2)40-49(39-45)43-53-51-35-29-30-36-52(51)54-44-50-41-47(33-27-23-19-15-11-7-3)38-48(42-50)34-28-24-20-16-12-8-4/h37-44,51-52H,5-36H2,1-4H3/b53-43+,54-44+/t51-,52-/m1/s1 |
| InChIKey | IQYNPJYJJKLYMW-KMDFTUILSA-N |
| XLogP | 16.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.27 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|