C66H96 — CID 101355748
1,3,5-tris[(E)-2-(3,5-dihexylphenyl)ethenyl]benzene (PubChem CID 101355748) has the molecular formula C66H96 and a molecular weight of 889.49 g/mol. Its IUPAC name is 1,3,5-tris[(E)-2-(3,5-dihexylphenyl)ethenyl]benzene.
| Compound Name | 1,3,5-tris[(E)-2-(3,5-dihexylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 101355748 |
| Molecular Formula | C66H96 |
| Molecular Weight | 889.49 g/mol |
| Exact Mass | 888.75 |
| IUPAC Name | 1,3,5-tris[(E)-2-(3,5-dihexylphenyl)ethenyl]benzene |
| SMILES | CCCCCCc1cc(/C=C/c2cc(/C=C/c3cc(CCCCCC)cc(CCCCCC)c3)cc(/C=C/c3cc(CCCCCC)cc(CCCCCC)c3)c2)cc(CCCCCC)c1 |
| InChI | InChI=1S/C66H96/c1-7-13-19-25-31-55-43-56(32-26-20-14-8-2)47-61(46-55)37-40-64-52-65(41-38-62-48-57(33-27-21-15-9-3)44-58(49-62)34-28-22-16-10-4)54-66(53-64)42-39-63-50-59(35-29-23-17-11-5)45-60(51-63)36-30-24-18-12-6/h37-54H,7-36H2,1-6H3/b40-37+,41-38+,42-39+ |
| InChIKey | XBNHUUJILABYFW-FHJKABMISA-N |
| XLogP | 20.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 36 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.49 |
| LogP ≤ 5 | 20.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|