C18H26O2 — CID 153458828
2-[3-[(E)-pent-1-enyl]-5-pentylphenyl]acetic acid (PubChem CID 153458828) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 2-[3-[(E)-pent-1-enyl]-5-pentylphenyl]acetic acid.
| Compound Name | 2-[3-[(E)-pent-1-enyl]-5-pentylphenyl]acetic acid |
|---|---|
| PubChem CID | 153458828 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-[3-[(E)-pent-1-enyl]-5-pentylphenyl]acetic acid |
| SMILES | CCC/C=C/c1cc(CCCCC)cc(CC(=O)O)c1 |
| InChI | InChI=1S/C18H26O2/c1-3-5-7-9-15-11-16(10-8-6-4-2)13-17(12-15)14-18(19)20/h7,9,11-13H,3-6,8,10,14H2,1-2H3,(H,19,20)/b9-7+ |
| InChIKey | DTMLPYZQTGGCFS-VQHVLOKHSA-N |
| XLogP | 4.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|