About 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one
1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one (PubChem CID 130263619) has the molecular formula C21H30O
and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one.
Molecular Properties
| Compound Name | 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one |
| PubChem CID | 130263619 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one |
| SMILES | CCCC/C=C/c1cc(/C=C/CCCC)cc(CC(C)=O)c1 |
| InChI | InChI=1S/C21H30O/c1-4-6-8-10-12-19-15-20(13-11-9-7-5-2)17-21(16-19)14-18(3)22/h10-13,15-17H,4-9,14H2,1-3H3/b12-10+,13-11+ |
| InChIKey | WMHQSLLAMYXZHS-DCIPZJNNSA-N |
| XLogP | 6.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one?
The IUPAC name of 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one (CID 130263619) is 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one.
What is the SMILES notation for 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one?
The canonical SMILES for 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one is CCCC/C=C/c1cc(/C=C/CCCC)cc(CC(C)=O)c1.
What is the InChIKey of 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one?
The InChIKey is WMHQSLLAMYXZHS-DCIPZJNNSA-N. The full InChI is InChI=1S/C21H30O/c1-4-6-8-10-12-19-15-20(13-11-9-7-5-2)17-21(16-19)14-18(3)22/h10-13,15-17H,4-9,14H2,1-3H3/b12-10+,13-11+.
What are the key properties of 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one?
1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one has a molecular weight of 298.47 g/mol, XLogP of 6.22, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis[(E)-hex-1-enyl]phenyl]propan-2-one is sourced from PubChem (CID 130263619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).