C40H64N3O+ — CID 136827369
3-[3-tert-butyl-5-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenyl]propyl-diethyl-methylazanium (PubChem CID 136827369) has the molecular formula C40H64N3O+ and a molecular weight of 602.97 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenyl]propyl-diethyl-methylazanium.
| Compound Name | 3-[3-tert-butyl-5-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenyl]propyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 136827369 |
| Molecular Formula | C40H64N3O+ |
| Molecular Weight | 602.97 g/mol |
| Exact Mass | 602.50 |
| IUPAC Name | 3-[3-tert-butyl-5-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenyl]propyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCCc1cc(/C=N/C2CCCCC2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H63N3O/c1-13-43(12,14-2)21-17-18-29-22-30(24-32(23-29)38(3,4)5)27-41-35-19-15-16-20-36(35)42-28-31-25-33(39(6,7)8)26-34(37(31)44)40(9,10)11/h22-28,35-36H,13-21H2,1-12H3/p+1/b41-27+ |
| InChIKey | NEDPYKXTNKWFPZ-GLNSOGGISA-O |
| XLogP | 9.55 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.97 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|