C37H56N2O2 — CID 143367608
4-butyl-2-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-pentan-2-ylphenol (PubChem CID 143367608) has the molecular formula C37H56N2O2 and a molecular weight of 560.87 g/mol. Its IUPAC name is 4-butyl-2-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-pentan-2-ylphenol.
| Compound Name | 4-butyl-2-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-pentan-2-ylphenol |
|---|---|
| PubChem CID | 143367608 |
| Molecular Formula | C37H56N2O2 |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 560.43 |
| IUPAC Name | 4-butyl-2-[[(1R,2R)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-pentan-2-ylphenol |
| SMILES | CCCCc1cc(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)CCC)c1 |
| InChI | InChI=1S/C37H56N2O2/c1-10-12-16-26-19-27(34(40)30(20-26)25(3)15-11-2)23-38-32-17-13-14-18-33(32)39-24-28-21-29(36(4,5)6)22-31(35(28)41)37(7,8)9/h19-25,32-33,40-41H,10-18H2,1-9H3/b38-23+,39-24+/t25?,32-,33-/m1/s1 |
| InChIKey | VUNOITNZZWEYAM-CXGYASOPSA-N |
| XLogP | 9.79 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|