C36H54N2O4 — CID 137213676
2-tert-butyl-6-[[2-[[3-tert-butyl-2-hydroxy-5-(4-hydroxybutyl)phenyl]methylideneamino]cyclohexyl]iminomethyl]-4-(4-hydroxybutyl)phenol (PubChem CID 137213676) has the molecular formula C36H54N2O4 and a molecular weight of 578.84 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2-[[3-tert-butyl-2-hydroxy-5-(4-hydroxybutyl)phenyl]methylideneamino]cyclohexyl]iminomethyl]-4-(4-hydroxybutyl)phenol.
| Compound Name | 2-tert-butyl-6-[[2-[[3-tert-butyl-2-hydroxy-5-(4-hydroxybutyl)phenyl]methylideneamino]cyclohexyl]iminomethyl]-4-(4-hydroxybutyl)phenol |
|---|---|
| PubChem CID | 137213676 |
| Molecular Formula | C36H54N2O4 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.41 |
| IUPAC Name | 2-tert-butyl-6-[[2-[[3-tert-butyl-2-hydroxy-5-(4-hydroxybutyl)phenyl]methylideneamino]cyclohexyl]iminomethyl]-4-(4-hydroxybutyl)phenol |
| SMILES | CC(C)(C)c1cc(CCCCO)cc(/C=N/C2CCCCC2/N=C/c2cc(CCCCO)cc(C(C)(C)C)c2O)c1O |
| InChI | InChI=1S/C36H54N2O4/c1-35(2,3)29-21-25(13-9-11-17-39)19-27(33(29)41)23-37-31-15-7-8-16-32(31)38-24-28-20-26(14-10-12-18-40)22-30(34(28)42)36(4,5)6/h19-24,31-32,39-42H,7-18H2,1-6H3/b37-23+,38-24+ |
| InChIKey | ACTQBYLXLHGNSB-DNJOOXRZSA-N |
| XLogP | 7.17 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|