C62H108N4O2 — CID 136690008
2-tert-butyl-6-[[(1S,2S)-2-[[3-tert-butyl-5-[(dioctylamino)methyl]-2-hydroxyphenyl]methylideneamino]cyclohexyl]iminomethyl]-4-[(dioctylamino)methyl]phenol (PubChem CID 136690008) has the molecular formula C62H108N4O2 and a molecular weight of 941.57 g/mol. Its IUPAC name is 2-tert-butyl-6-[[(1S,2S)-2-[[3-tert-butyl-5-[(dioctylamino)methyl]-2-hydroxyphenyl]methylideneamino]cyclohexyl]iminomethyl]-4-[(dioctylamino)methyl]phenol.
| Compound Name | 2-tert-butyl-6-[[(1S,2S)-2-[[3-tert-butyl-5-[(dioctylamino)methyl]-2-hydroxyphenyl]methylideneamino]cyclohexyl]iminomethyl]-4-[(dioctylamino)methyl]phenol |
|---|---|
| PubChem CID | 136690008 |
| Molecular Formula | C62H108N4O2 |
| Molecular Weight | 941.57 g/mol |
| Exact Mass | 940.85 |
| IUPAC Name | 2-tert-butyl-6-[[(1S,2S)-2-[[3-tert-butyl-5-[(dioctylamino)methyl]-2-hydroxyphenyl]methylideneamino]cyclohexyl]iminomethyl]-4-[(dioctylamino)methyl]phenol |
| SMILES | CCCCCCCCN(CCCCCCCC)Cc1cc(/C=N/[C@H]2CCCC[C@@H]2/N=C/c2cc(CN(CCCCCCCC)CCCCCCCC)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C62H108N4O2/c1-11-15-19-23-27-33-39-65(40-34-28-24-20-16-12-2)49-51-43-53(59(67)55(45-51)61(5,6)7)47-63-57-37-31-32-38-58(57)64-48-54-44-52(46-56(60(54)68)62(8,9)10)50-66(41-35-29-25-21-17-13-3)42-36-30-26-22-18-14-4/h43-48,57-58,67-68H,11-42,49-50H2,1-10H3/b63-47+,64-48+/t57-,58-/m0/s1 |
| InChIKey | KLUAZOIRIZBNNZ-WBIOWTLVSA-N |
| XLogP | 17.59 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.57 |
| LogP ≤ 5 | 17.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|