C30H40Cl2N2O2 — CID 136760098
2-tert-butyl-6-[[2-[[3-tert-butyl-5-(chloromethyl)-2-hydroxyphenyl]methylideneamino]cyclohexyl]iminomethyl]-4-(chloromethyl)phenol (PubChem CID 136760098) has the molecular formula C30H40Cl2N2O2 and a molecular weight of 531.57 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2-[[3-tert-butyl-5-(chloromethyl)-2-hydroxyphenyl]methylideneamino]cyclohexyl]iminomethyl]-4-(chloromethyl)phenol.
| Compound Name | 2-tert-butyl-6-[[2-[[3-tert-butyl-5-(chloromethyl)-2-hydroxyphenyl]methylideneamino]cyclohexyl]iminomethyl]-4-(chloromethyl)phenol |
|---|---|
| PubChem CID | 136760098 |
| Molecular Formula | C30H40Cl2N2O2 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2-tert-butyl-6-[[2-[[3-tert-butyl-5-(chloromethyl)-2-hydroxyphenyl]methylideneamino]cyclohexyl]iminomethyl]-4-(chloromethyl)phenol |
| SMILES | CC(C)(C)c1cc(CCl)cc(/C=N/C2CCCCC2/N=C/c2cc(CCl)cc(C(C)(C)C)c2O)c1O |
| InChI | InChI=1S/C30H40Cl2N2O2/c1-29(2,3)23-13-19(15-31)11-21(27(23)35)17-33-25-9-7-8-10-26(25)34-18-22-12-20(16-32)14-24(28(22)36)30(4,5)6/h11-14,17-18,25-26,35-36H,7-10,15-16H2,1-6H3/b33-17+,34-18+ |
| InChIKey | FIAFMBALTQNXON-WMFSDKRHSA-N |
| XLogP | 8.02 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|