C13H20O — CID 142279374
(3S)-3,4,5,6-tetramethyl-3,4,4a,8a-tetrahydro-1H-isochromene (PubChem CID 142279374) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (3S)-3,4,5,6-tetramethyl-3,4,4a,8a-tetrahydro-1H-isochromene.
| Compound Name | (3S)-3,4,5,6-tetramethyl-3,4,4a,8a-tetrahydro-1H-isochromene |
|---|---|
| PubChem CID | 142279374 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (3S)-3,4,5,6-tetramethyl-3,4,4a,8a-tetrahydro-1H-isochromene |
| SMILES | CC1=C(C)C2C(C=C1)CO[C@@H](C)C2C |
| InChI | InChI=1S/C13H20O/c1-8-5-6-12-7-14-11(4)10(3)13(12)9(8)2/h5-6,10-13H,7H2,1-4H3/t10?,11-,12?,13?/m0/s1 |
| InChIKey | BKCRPIGOIVCQMG-ZNOXQBFJSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |