About 9-ethyl-1H-fluorene;methane
9-ethyl-1H-fluorene;methane (PubChem CID 142105135) has the molecular formula C16H18
and a molecular weight of 210.32 g/mol. Its IUPAC name is 9-ethyl-1H-fluorene;methane.
Molecular Properties
| Compound Name | 9-ethyl-1H-fluorene;methane |
| PubChem CID | 142105135 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 9-ethyl-1H-fluorene;methane |
| SMILES | C.CCC1=C2CC=CC=C2c2ccccc21 |
| InChI | InChI=1S/C15H14.CH4/c1-2-11-12-7-3-5-9-14(12)15-10-6-4-8-13(11)15;/h3-7,9-10H,2,8H2,1H3;1H4 |
| InChIKey | SCBMCEOQSDAVQO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9-ethyl-1H-fluorene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-1H-fluorene;methane?
The IUPAC name of 9-ethyl-1H-fluorene;methane (CID 142105135) is 9-ethyl-1H-fluorene;methane.
What is the SMILES notation for 9-ethyl-1H-fluorene;methane?
The canonical SMILES for 9-ethyl-1H-fluorene;methane is C.CCC1=C2CC=CC=C2c2ccccc21.
What is the InChIKey of 9-ethyl-1H-fluorene;methane?
The InChIKey is SCBMCEOQSDAVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14.CH4/c1-2-11-12-7-3-5-9-14(12)15-10-6-4-8-13(11)15;/h3-7,9-10H,2,8H2,1H3;1H4.
What are the key properties of 9-ethyl-1H-fluorene;methane?
9-ethyl-1H-fluorene;methane has a molecular weight of 210.32 g/mol, XLogP of 4.84, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-1H-fluorene;methane is sourced from PubChem (CID 142105135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).