C20H23N — CID 144960325
2-cyclopenta-1,3-dien-1-ylaniline;1-ethyl-4-methylbenzene (PubChem CID 144960325) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-ylaniline;1-ethyl-4-methylbenzene.
| Compound Name | 2-cyclopenta-1,3-dien-1-ylaniline;1-ethyl-4-methylbenzene |
|---|---|
| PubChem CID | 144960325 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-ylaniline;1-ethyl-4-methylbenzene |
| SMILES | CCc1ccc(C)cc1.Nc1ccccc1C1=CC=CC1 |
| InChI | InChI=1S/C11H11N.C9H12/c12-11-8-4-3-7-10(11)9-5-1-2-6-9;1-3-9-6-4-8(2)5-7-9/h1-5,7-8H,6,12H2;4-7H,3H2,1-2H3 |
| InChIKey | XSFMQOQLYAJLQM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|