C20H22 — CID 59165309
1-methyl-3-(3-methyl-4,7-dihydro-2H-inden-1-yl)-4,7-dihydro-2H-indene (PubChem CID 59165309) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-methyl-3-(3-methyl-4,7-dihydro-2H-inden-1-yl)-4,7-dihydro-2H-indene.
| Compound Name | 1-methyl-3-(3-methyl-4,7-dihydro-2H-inden-1-yl)-4,7-dihydro-2H-indene |
|---|---|
| PubChem CID | 59165309 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-methyl-3-(3-methyl-4,7-dihydro-2H-inden-1-yl)-4,7-dihydro-2H-indene |
| SMILES | CC1=C2CC=CCC2=C(C2=C3CC=CCC3=C(C)C2)C1 |
| InChI | InChI=1S/C20H22/c1-13-11-19(17-9-5-3-7-15(13)17)20-12-14(2)16-8-4-6-10-18(16)20/h3-6H,7-12H2,1-2H3 |
| InChIKey | FLHLFRXTONBYFR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|