C13H16 — CID 123842957
2-ethyl-7-methyl-1,4-dihydronaphthalene (PubChem CID 123842957) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-ethyl-7-methyl-1,4-dihydronaphthalene.
| Compound Name | 2-ethyl-7-methyl-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 123842957 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-ethyl-7-methyl-1,4-dihydronaphthalene |
| SMILES | CCC1=CCc2ccc(C)cc2C1 |
| InChI | InChI=1S/C13H16/c1-3-11-5-7-12-6-4-10(2)8-13(12)9-11/h4-6,8H,3,7,9H2,1-2H3 |
| InChIKey | OPXXYHPOYZPURB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|