C18H17F — CID 139961869
2-(4-ethylphenyl)-7-fluoro-1,4-dihydronaphthalene (PubChem CID 139961869) has the molecular formula C18H17F and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-7-fluoro-1,4-dihydronaphthalene.
| Compound Name | 2-(4-ethylphenyl)-7-fluoro-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139961869 |
| Molecular Formula | C18H17F |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-(4-ethylphenyl)-7-fluoro-1,4-dihydronaphthalene |
| SMILES | CCc1ccc(C2=CCc3ccc(F)cc3C2)cc1 |
| InChI | InChI=1S/C18H17F/c1-2-13-3-5-14(6-4-13)16-8-7-15-9-10-18(19)12-17(15)11-16/h3-6,8-10,12H,2,7,11H2,1H3 |
| InChIKey | MZYDXGQHPYEUNF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |