C19H19FO — CID 139960710
2-(4-ethylphenyl)-5-fluoro-6-methoxy-1,4-dihydronaphthalene (PubChem CID 139960710) has the molecular formula C19H19FO and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-5-fluoro-6-methoxy-1,4-dihydronaphthalene.
| Compound Name | 2-(4-ethylphenyl)-5-fluoro-6-methoxy-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139960710 |
| Molecular Formula | C19H19FO |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-(4-ethylphenyl)-5-fluoro-6-methoxy-1,4-dihydronaphthalene |
| SMILES | CCc1ccc(C2=CCc3c(ccc(OC)c3F)C2)cc1 |
| InChI | InChI=1S/C19H19FO/c1-3-13-4-6-14(7-5-13)15-8-10-17-16(12-15)9-11-18(21-2)19(17)20/h4-9,11H,3,10,12H2,1-2H3 |
| InChIKey | TZQRGGSIXQVMFV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |