About 5-methyl-2-propyl-1,3-dihydroisoindole
5-methyl-2-propyl-1,3-dihydroisoindole (PubChem CID 130841289) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 5-methyl-2-propyl-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 5-methyl-2-propyl-1,3-dihydroisoindole |
| PubChem CID | 130841289 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 5-methyl-2-propyl-1,3-dihydroisoindole |
| SMILES | CCCN1Cc2ccc(C)cc2C1 |
| InChI | InChI=1S/C12H17N/c1-3-6-13-8-11-5-4-10(2)7-12(11)9-13/h4-5,7H,3,6,8-9H2,1-2H3 |
| InChIKey | QFQKRSNHDDHKCB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-2-propyl-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-propyl-1,3-dihydroisoindole?
The IUPAC name of 5-methyl-2-propyl-1,3-dihydroisoindole (CID 130841289) is 5-methyl-2-propyl-1,3-dihydroisoindole.
What is the SMILES notation for 5-methyl-2-propyl-1,3-dihydroisoindole?
The canonical SMILES for 5-methyl-2-propyl-1,3-dihydroisoindole is CCCN1Cc2ccc(C)cc2C1.
What is the InChIKey of 5-methyl-2-propyl-1,3-dihydroisoindole?
The InChIKey is QFQKRSNHDDHKCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-3-6-13-8-11-5-4-10(2)7-12(11)9-13/h4-5,7H,3,6,8-9H2,1-2H3.
What are the key properties of 5-methyl-2-propyl-1,3-dihydroisoindole?
5-methyl-2-propyl-1,3-dihydroisoindole has a molecular weight of 175.27 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-propyl-1,3-dihydroisoindole is sourced from PubChem (CID 130841289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).