C13H20ClN — CID 178136761
5-chloro-2-propyl-1,3-dihydroisoindole;ethane (PubChem CID 178136761) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 5-chloro-2-propyl-1,3-dihydroisoindole;ethane.
| Compound Name | 5-chloro-2-propyl-1,3-dihydroisoindole;ethane |
|---|---|
| PubChem CID | 178136761 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 5-chloro-2-propyl-1,3-dihydroisoindole;ethane |
| SMILES | CC.CCCN1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C11H14ClN.C2H6/c1-2-5-13-7-9-3-4-11(12)6-10(9)8-13;1-2/h3-4,6H,2,5,7-8H2,1H3;1-2H3 |
| InChIKey | JUFWGWUFPSZHKJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |