4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid

C12H14ClNO2 — CID 82164089

IUPAC4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid
SMILESO=C(O)CCCN1Cc2ccc(Cl)cc2C1
InChIInChI=1S/C12H14ClNO2/c13-11-4-3-9-7-14(8-10(9)6-11)5-1-2-12(15)16/h3-4,6H,1-2,5,7-8H2,(H,15,16)
InChIKeyWPSLKHFSTYBPBM-UHFFFAOYSA-N
MW239.70 g/mol
LogP2.52
Rot. Bonds4

About 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid

4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid (PubChem CID 82164089) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid.

Molecular Properties

Compound Name4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid
PubChem CID82164089
Molecular FormulaC12H14ClNO2
Molecular Weight239.70 g/mol
Exact Mass239.07
IUPAC Name4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid
SMILESO=C(O)CCCN1Cc2ccc(Cl)cc2C1
InChIInChI=1S/C12H14ClNO2/c13-11-4-3-9-7-14(8-10(9)6-11)5-1-2-12(15)16/h3-4,6H,1-2,5,7-8H2,(H,15,16)
InChIKeyWPSLKHFSTYBPBM-UHFFFAOYSA-N
XLogP2.52
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.70
LogP ≤ 52.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid?
The IUPAC name of 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid (CID 82164089) is 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid.
What is the SMILES notation for 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid?
The canonical SMILES for 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid is O=C(O)CCCN1Cc2ccc(Cl)cc2C1.
What is the InChIKey of 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid?
The InChIKey is WPSLKHFSTYBPBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO2/c13-11-4-3-9-7-14(8-10(9)6-11)5-1-2-12(15)16/h3-4,6H,1-2,5,7-8H2,(H,15,16).
What are the key properties of 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid?
4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid has a molecular weight of 239.70 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid is sourced from PubChem (CID 82164089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).