C12H14ClNO2 — CID 82164089
4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid (PubChem CID 82164089) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid.
| Compound Name | 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 82164089 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-(5-chloro-1,3-dihydroisoindol-2-yl)butanoic acid |
| SMILES | O=C(O)CCCN1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H14ClNO2/c13-11-4-3-9-7-14(8-10(9)6-11)5-1-2-12(15)16/h3-4,6H,1-2,5,7-8H2,(H,15,16) |
| InChIKey | WPSLKHFSTYBPBM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |