C24H26ClNO3 — CID 70400922
4-[4-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-3-oxopiperidin-1-yl]butanoic acid (PubChem CID 70400922) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is 4-[4-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-3-oxopiperidin-1-yl]butanoic acid.
| Compound Name | 4-[4-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-3-oxopiperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 70400922 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-[4-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-3-oxopiperidin-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CCC(C2c3ccccc3CCc3ccc(Cl)cc32)C(=O)C1 |
| InChI | InChI=1S/C24H26ClNO3/c25-18-10-9-17-8-7-16-4-1-2-5-19(16)24(21(17)14-18)20-11-13-26(15-22(20)27)12-3-6-23(28)29/h1-2,4-5,9-10,14,20,24H,3,6-8,11-13,15H2,(H,28,29) |
| InChIKey | YSQJMQCCFKDQEF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |