C10H12ClNO — CID 82164081
2-(5-chloro-1,3-dihydroisoindol-2-yl)ethanol (PubChem CID 82164081) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dihydroisoindol-2-yl)ethanol.
| Compound Name | 2-(5-chloro-1,3-dihydroisoindol-2-yl)ethanol |
|---|---|
| PubChem CID | 82164081 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-(5-chloro-1,3-dihydroisoindol-2-yl)ethanol |
| SMILES | OCCN1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C10H12ClNO/c11-10-2-1-8-6-12(3-4-13)7-9(8)5-10/h1-2,5,13H,3-4,6-7H2 |
| InChIKey | DHKWDTCACXTMKS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |