About 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline
2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline (PubChem CID 165347376) has the molecular formula C13H15N3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline.
Molecular Properties
| Compound Name | 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline |
| PubChem CID | 165347376 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline |
| SMILES | CCCN1Cc2nc3ccccc3nc2C1 |
| InChI | InChI=1S/C13H15N3/c1-2-7-16-8-12-13(9-16)15-11-6-4-3-5-10(11)14-12/h3-6H,2,7-9H2,1H3 |
| InChIKey | NKLOIQWDQFDVBF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline?
The IUPAC name of 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline (CID 165347376) is 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline.
What is the SMILES notation for 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline?
The canonical SMILES for 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline is CCCN1Cc2nc3ccccc3nc2C1.
What is the InChIKey of 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline?
The InChIKey is NKLOIQWDQFDVBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3/c1-2-7-16-8-12-13(9-16)15-11-6-4-3-5-10(11)14-12/h3-6H,2,7-9H2,1H3.
What are the key properties of 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline?
2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline has a molecular weight of 213.28 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-1,3-dihydropyrrolo[3,4-b]quinoxaline is sourced from PubChem (CID 165347376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).