C12H13N — CID 123592025
5-methyl-2-prop-2-ynyl-1,3-dihydroisoindole (PubChem CID 123592025) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 5-methyl-2-prop-2-ynyl-1,3-dihydroisoindole.
| Compound Name | 5-methyl-2-prop-2-ynyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 123592025 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 5-methyl-2-prop-2-ynyl-1,3-dihydroisoindole |
| SMILES | C#CCN1Cc2ccc(C)cc2C1 |
| InChI | InChI=1S/C12H13N/c1-3-6-13-8-11-5-4-10(2)7-12(11)9-13/h1,4-5,7H,6,8-9H2,2H3 |
| InChIKey | LHRGYYABQBLODN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|