C15H23N3 — CID 70171773
2-(4-ethylpiperazin-1-yl)-5-methyl-1,3-dihydroisoindole (PubChem CID 70171773) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-5-methyl-1,3-dihydroisoindole.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-5-methyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 70171773 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-5-methyl-1,3-dihydroisoindole |
| SMILES | CCN1CCN(N2Cc3ccc(C)cc3C2)CC1 |
| InChI | InChI=1S/C15H23N3/c1-3-16-6-8-17(9-7-16)18-11-14-5-4-13(2)10-15(14)12-18/h4-5,10H,3,6-9,11-12H2,1-2H3 |
| InChIKey | GJCBWFWIKVSHHC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |