C11H11Br — CID 143041674
5-bromo-1-methyl-2,3-dihydronaphthalene (PubChem CID 143041674) has the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. Its IUPAC name is 5-bromo-1-methyl-2,3-dihydronaphthalene.
| Compound Name | 5-bromo-1-methyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 143041674 |
| Molecular Formula | C11H11Br |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 5-bromo-1-methyl-2,3-dihydronaphthalene |
| SMILES | CC1=c2cccc(Br)c2=CCC1 |
| InChI | InChI=1S/C11H11Br/c1-8-4-2-6-10-9(8)5-3-7-11(10)12/h3,5-7H,2,4H2,1H3 |
| InChIKey | IVCLYJDRMSBZHX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |