C8H13N — CID 143080216
5,6-dimethylcyclohexa-1,5-dien-1-amine (PubChem CID 143080216) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 5,6-dimethylcyclohexa-1,5-dien-1-amine.
| Compound Name | 5,6-dimethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 143080216 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 5,6-dimethylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1=C(C)C(N)=CCC1 |
| InChI | InChI=1S/C8H13N/c1-6-4-3-5-8(9)7(6)2/h5H,3-4,9H2,1-2H3 |
| InChIKey | FGGLGZGKKKZYQR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |