C9H17N — CID 144692983
ethane;5-methylcyclohexa-1,5-dien-1-amine (PubChem CID 144692983) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is ethane;5-methylcyclohexa-1,5-dien-1-amine.
| Compound Name | ethane;5-methylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 144692983 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | ethane;5-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CC.CC1=CC(N)=CCC1 |
| InChI | InChI=1S/C7H11N.C2H6/c1-6-3-2-4-7(8)5-6;1-2/h4-5H,2-3,8H2,1H3;1-2H3 |
| InChIKey | DDBROSWWXZGSQK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |