C7H11NO — CID 177191938
7-methyl-2,3-dihydrooxepin-5-amine (PubChem CID 177191938) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 7-methyl-2,3-dihydrooxepin-5-amine.
| Compound Name | 7-methyl-2,3-dihydrooxepin-5-amine |
|---|---|
| PubChem CID | 177191938 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 7-methyl-2,3-dihydrooxepin-5-amine |
| SMILES | CC1=CC(N)=CCCO1 |
| InChI | InChI=1S/C7H11NO/c1-6-5-7(8)3-2-4-9-6/h3,5H,2,4,8H2,1H3 |
| InChIKey | VLXOTZQGCFXRPI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |