C6H12OSi — CID 71429749
2,3-dihydrofuran-5-yl(dimethyl)silane (PubChem CID 71429749) has the molecular formula C6H12OSi and a molecular weight of 128.25 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl(dimethyl)silane.
| Compound Name | 2,3-dihydrofuran-5-yl(dimethyl)silane |
|---|---|
| PubChem CID | 71429749 |
| Molecular Formula | C6H12OSi |
| Molecular Weight | 128.25 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 2,3-dihydrofuran-5-yl(dimethyl)silane |
| SMILES | C[SiH](C)C1=CCCO1 |
| InChI | InChI=1S/C6H12OSi/c1-8(2)6-4-3-5-7-6/h4,8H,3,5H2,1-2H3 |
| InChIKey | WATBYKGABWKTLP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|