C10H16O2Si — CID 12929512
bis(2,3-dihydrofuran-5-yl)-dimethylsilane (PubChem CID 12929512) has the molecular formula C10H16O2Si and a molecular weight of 196.32 g/mol. Its IUPAC name is bis(2,3-dihydrofuran-5-yl)-dimethylsilane.
| Compound Name | bis(2,3-dihydrofuran-5-yl)-dimethylsilane |
|---|---|
| PubChem CID | 12929512 |
| Molecular Formula | C10H16O2Si |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | bis(2,3-dihydrofuran-5-yl)-dimethylsilane |
| SMILES | C[Si](C)(C1=CCCO1)C1=CCCO1 |
| InChI | InChI=1S/C10H16O2Si/c1-13(2,9-5-3-7-11-9)10-6-4-8-12-10/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | OELIPQIOARHJPG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|