C12H22O3Si — CID 134969002
ethyl (2R)-2-[3,4-dihydro-2H-pyran-6-yl(dimethyl)silyl]propanoate (PubChem CID 134969002) has the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. Its IUPAC name is ethyl (2R)-2-[3,4-dihydro-2H-pyran-6-yl(dimethyl)silyl]propanoate.
| Compound Name | ethyl (2R)-2-[3,4-dihydro-2H-pyran-6-yl(dimethyl)silyl]propanoate |
|---|---|
| PubChem CID | 134969002 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | ethyl (2R)-2-[3,4-dihydro-2H-pyran-6-yl(dimethyl)silyl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)[Si](C)(C)C1=CCCCO1 |
| InChI | InChI=1S/C12H22O3Si/c1-5-14-12(13)10(2)16(3,4)11-8-6-7-9-15-11/h8,10H,5-7,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | MALWACIYNZJPIT-SNVBAGLBSA-N |
| XLogP | 2.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|