C12H23NO2 — CID 102648063
1-(3,4-dihydro-2H-pyran-6-yl)-2-ethoxypentan-1-amine (PubChem CID 102648063) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-2-ethoxypentan-1-amine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2-ethoxypentan-1-amine |
|---|---|
| PubChem CID | 102648063 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2-ethoxypentan-1-amine |
| SMILES | CCCC(OCC)C(N)C1=CCCCO1 |
| InChI | InChI=1S/C12H23NO2/c1-3-7-10(14-4-2)12(13)11-8-5-6-9-15-11/h8,10,12H,3-7,9,13H2,1-2H3 |
| InChIKey | CUMLJLWSRSUXPH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |