C11H21NO3 — CID 102647793
1-(3,4-dihydro-2H-pyran-6-yl)-2,2-diethoxyethanamine (PubChem CID 102647793) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-2,2-diethoxyethanamine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 102647793 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2,2-diethoxyethanamine |
| SMILES | CCOC(OCC)C(N)C1=CCCCO1 |
| InChI | InChI=1S/C11H21NO3/c1-3-13-11(14-4-2)10(12)9-7-5-6-8-15-9/h7,10-11H,3-6,8,12H2,1-2H3 |
| InChIKey | LEUIYHYKBMXNPE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|