C13H25NO2 — CID 106653819
1-(cyclohepten-1-yl)-2,2-diethoxyethanamine (PubChem CID 106653819) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2,2-diethoxyethanamine.
| Compound Name | 1-(cyclohepten-1-yl)-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 106653819 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2,2-diethoxyethanamine |
| SMILES | CCOC(OCC)C(N)C1=CCCCCC1 |
| InChI | InChI=1S/C13H25NO2/c1-3-15-13(16-4-2)12(14)11-9-7-5-6-8-10-11/h9,12-13H,3-8,10,14H2,1-2H3 |
| InChIKey | VPSUJDKVTWDHTN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|