C9H17NO — CID 102651898
1-(2,3-dihydrofuran-5-yl)pentan-1-amine (PubChem CID 102651898) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)pentan-1-amine.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)pentan-1-amine |
|---|---|
| PubChem CID | 102651898 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)pentan-1-amine |
| SMILES | CCCCC(N)C1=CCCO1 |
| InChI | InChI=1S/C9H17NO/c1-2-3-5-8(10)9-6-4-7-11-9/h6,8H,2-5,7,10H2,1H3 |
| InChIKey | WRXQOSCDASIGOP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |