C13H19NOS — CID 102649485
1-(3,4-dihydro-2H-pyran-6-yl)-4-thiophen-2-ylbutan-1-amine (PubChem CID 102649485) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-4-thiophen-2-ylbutan-1-amine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-4-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 102649485 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-4-thiophen-2-ylbutan-1-amine |
| SMILES | NC(CCCc1cccs1)C1=CCCCO1 |
| InChI | InChI=1S/C13H19NOS/c14-12(13-8-1-2-9-15-13)7-3-5-11-6-4-10-16-11/h4,6,8,10,12H,1-3,5,7,9,14H2 |
| InChIKey | MEMMKKVPXCYFHY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |