C13H16BrNO — CID 102647143
2-(3-bromophenyl)-1-(3,4-dihydro-2H-pyran-6-yl)ethanamine (PubChem CID 102647143) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(3,4-dihydro-2H-pyran-6-yl)ethanamine.
| Compound Name | 2-(3-bromophenyl)-1-(3,4-dihydro-2H-pyran-6-yl)ethanamine |
|---|---|
| PubChem CID | 102647143 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-(3-bromophenyl)-1-(3,4-dihydro-2H-pyran-6-yl)ethanamine |
| SMILES | NC(Cc1cccc(Br)c1)C1=CCCCO1 |
| InChI | InChI=1S/C13H16BrNO/c14-11-5-3-4-10(8-11)9-12(15)13-6-1-2-7-16-13/h3-6,8,12H,1-2,7,9,15H2 |
| InChIKey | DCPSVTIPSYTURN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |