C12H14BrNO — CID 102651201
2-(4-bromophenyl)-1-(2,3-dihydrofuran-5-yl)ethanamine (PubChem CID 102651201) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(2,3-dihydrofuran-5-yl)ethanamine.
| Compound Name | 2-(4-bromophenyl)-1-(2,3-dihydrofuran-5-yl)ethanamine |
|---|---|
| PubChem CID | 102651201 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-(4-bromophenyl)-1-(2,3-dihydrofuran-5-yl)ethanamine |
| SMILES | NC(Cc1ccc(Br)cc1)C1=CCCO1 |
| InChI | InChI=1S/C12H14BrNO/c13-10-5-3-9(4-6-10)8-11(14)12-2-1-7-15-12/h2-6,11H,1,7-8,14H2 |
| InChIKey | UWEBRJDTMLWNKG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |