C13H17NO — CID 102651207
2,3-dihydrofuran-5-yl-(4-ethylphenyl)methanamine (PubChem CID 102651207) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(4-ethylphenyl)methanamine.
| Compound Name | 2,3-dihydrofuran-5-yl-(4-ethylphenyl)methanamine |
|---|---|
| PubChem CID | 102651207 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(4-ethylphenyl)methanamine |
| SMILES | CCc1ccc(C(N)C2=CCCO2)cc1 |
| InChI | InChI=1S/C13H17NO/c1-2-10-5-7-11(8-6-10)13(14)12-4-3-9-15-12/h4-8,13H,2-3,9,14H2,1H3 |
| InChIKey | ITDSMNDARLNFKA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |