C10H19NO2 — CID 102653078
1-(2,3-dihydrofuran-5-yl)-4-methoxypentan-1-amine (PubChem CID 102653078) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-4-methoxypentan-1-amine.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-4-methoxypentan-1-amine |
|---|---|
| PubChem CID | 102653078 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-4-methoxypentan-1-amine |
| SMILES | COC(C)CCC(N)C1=CCCO1 |
| InChI | InChI=1S/C10H19NO2/c1-8(12-2)5-6-9(11)10-4-3-7-13-10/h4,8-9H,3,5-7,11H2,1-2H3 |
| InChIKey | WZOZUGUEQDCTMN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |