About 5-(5-methylnonyl)-2,3-dihydrofuran
5-(5-methylnonyl)-2,3-dihydrofuran (PubChem CID 174857190) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is 5-(5-methylnonyl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 5-(5-methylnonyl)-2,3-dihydrofuran |
| PubChem CID | 174857190 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 5-(5-methylnonyl)-2,3-dihydrofuran |
| SMILES | CCCCC(C)CCCCC1=CCCO1 |
| InChI | InChI=1S/C14H26O/c1-3-4-8-13(2)9-5-6-10-14-11-7-12-15-14/h11,13H,3-10,12H2,1-2H3 |
| InChIKey | SZBGASORXQMBER-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-methylnonyl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methylnonyl)-2,3-dihydrofuran?
The IUPAC name of 5-(5-methylnonyl)-2,3-dihydrofuran (CID 174857190) is 5-(5-methylnonyl)-2,3-dihydrofuran.
What is the SMILES notation for 5-(5-methylnonyl)-2,3-dihydrofuran?
The canonical SMILES for 5-(5-methylnonyl)-2,3-dihydrofuran is CCCCC(C)CCCCC1=CCCO1.
What is the InChIKey of 5-(5-methylnonyl)-2,3-dihydrofuran?
The InChIKey is SZBGASORXQMBER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O/c1-3-4-8-13(2)9-5-6-10-14-11-7-12-15-14/h11,13H,3-10,12H2,1-2H3.
What are the key properties of 5-(5-methylnonyl)-2,3-dihydrofuran?
5-(5-methylnonyl)-2,3-dihydrofuran has a molecular weight of 210.36 g/mol, XLogP of 4.68, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methylnonyl)-2,3-dihydrofuran is sourced from PubChem (CID 174857190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).