About (5S)-5-methylnonadecane
(5S)-5-methylnonadecane (PubChem CID 170848384) has the molecular formula C20H42
and a molecular weight of 282.56 g/mol. Its IUPAC name is (5S)-5-methylnonadecane.
Molecular Properties
| Compound Name | (5S)-5-methylnonadecane |
| PubChem CID | 170848384 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | (5S)-5-methylnonadecane |
| SMILES | CCCCCCCCCCCCCC[C@@H](C)CCCC |
| InChI | InChI=1S/C20H42/c1-4-6-8-9-10-11-12-13-14-15-16-17-19-20(3)18-7-5-2/h20H,4-19H2,1-3H3/t20-/m0/s1 |
| InChIKey | ZFWCHSBHHWYGCK-FQEVSTJZSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-methylnonadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methylnonadecane?
The IUPAC name of (5S)-5-methylnonadecane (CID 170848384) is (5S)-5-methylnonadecane.
What is the SMILES notation for (5S)-5-methylnonadecane?
The canonical SMILES for (5S)-5-methylnonadecane is CCCCCCCCCCCCCC[C@@H](C)CCCC.
What is the InChIKey of (5S)-5-methylnonadecane?
The InChIKey is ZFWCHSBHHWYGCK-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H42/c1-4-6-8-9-10-11-12-13-14-15-16-17-19-20(3)18-7-5-2/h20H,4-19H2,1-3H3/t20-/m0/s1.
What are the key properties of (5S)-5-methylnonadecane?
(5S)-5-methylnonadecane has a molecular weight of 282.56 g/mol, XLogP of 7.90, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methylnonadecane is sourced from PubChem (CID 170848384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).